C51H38BN3 — CID 153293332
5-[3-[3-deuterio-5-(3,5-diphenylphenyl)phenyl]phenyl]-8,14,22-trimethyl-8,14,22-triaza-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene (PubChem CID 153293332) has the molecular formula C51H38BN3 and a molecular weight of 704.70 g/mol. Its IUPAC name is 5-[3-[3-deuterio-5-(3,5-diphenylphenyl)phenyl]phenyl]-8,14,22-trimethyl-8,14,22-triaza-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 5-[3-[3-deuterio-5-(3,5-diphenylphenyl)phenyl]phenyl]-8,14,22-trimethyl-8,14,22-triaza-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 153293332 |
| Molecular Formula | C51H38BN3 |
| Molecular Weight | 704.70 g/mol |
| Exact Mass | 704.32 |
| IUPAC Name | 5-[3-[3-deuterio-5-(3,5-diphenylphenyl)phenyl]phenyl]-8,14,22-trimethyl-8,14,22-triaza-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene |
| SMILES | [2H]c1cc(-c2cccc(-c3cc4c5c(c3)N(C)c3cccc6c3B5c3c(cccc3N4C)N6C)c2)cc(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C51H38BN3/c1-53-43-22-12-24-45-49(43)52-50-44(53)23-13-25-46(50)55(3)48-32-42(31-47(51(48)52)54(45)2)38-21-11-19-36(27-38)35-18-10-20-37(26-35)41-29-39(33-14-6-4-7-15-33)28-40(30-41)34-16-8-5-9-17-34/h4-32H,1-3H3/i10D |
| InChIKey | KWDBAPAVUBYVOU-MMIHMFRQSA-N |
| XLogP | 10.78 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.70 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|