C16H23ClN2O3 — CID 153296021
benzyl N-[(1R,2R,5R)-2-[(chloroamino)methyl]-2-hydroxy-5-methylcyclohexyl]carbamate (PubChem CID 153296021) has the molecular formula C16H23ClN2O3 and a molecular weight of 326.82 g/mol. Its IUPAC name is benzyl N-[(1R,2R,5R)-2-[(chloroamino)methyl]-2-hydroxy-5-methylcyclohexyl]carbamate.
| Compound Name | benzyl N-[(1R,2R,5R)-2-[(chloroamino)methyl]-2-hydroxy-5-methylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 153296021 |
| Molecular Formula | C16H23ClN2O3 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | benzyl N-[(1R,2R,5R)-2-[(chloroamino)methyl]-2-hydroxy-5-methylcyclohexyl]carbamate |
| SMILES | C[C@@H]1CC[C@@](O)(CNCl)[C@H](NC(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C16H23ClN2O3/c1-12-7-8-16(21,11-18-17)14(9-12)19-15(20)22-10-13-5-3-2-4-6-13/h2-6,12,14,18,21H,7-11H2,1H3,(H,19,20)/t12-,14-,16-/m1/s1 |
| InChIKey | MZNZYKZAAOJGHG-XNRPHZJLSA-N |
| XLogP | 2.58 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|