C8H17NO3S — CID 153296040
2-(aminomethyl)-5-methylsulfonylcyclohexan-1-ol (PubChem CID 153296040) has the molecular formula C8H17NO3S and a molecular weight of 207.29 g/mol. Its IUPAC name is 2-(aminomethyl)-5-methylsulfonylcyclohexan-1-ol.
| Compound Name | 2-(aminomethyl)-5-methylsulfonylcyclohexan-1-ol |
|---|---|
| PubChem CID | 153296040 |
| Molecular Formula | C8H17NO3S |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-(aminomethyl)-5-methylsulfonylcyclohexan-1-ol |
| SMILES | CS(=O)(=O)C1CCC(CN)C(O)C1 |
| InChI | InChI=1S/C8H17NO3S/c1-13(11,12)7-3-2-6(5-9)8(10)4-7/h6-8,10H,2-5,9H2,1H3 |
| InChIKey | GYXNYNPAMFCLRH-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |