C11H15BrN2O — CID 153296304
(Z)-1-N-(4-bromo-2-methoxyphenyl)but-1-ene-1,2-diamine (PubChem CID 153296304) has the molecular formula C11H15BrN2O and a molecular weight of 271.16 g/mol. Its IUPAC name is (Z)-1-N-(4-bromo-2-methoxyphenyl)but-1-ene-1,2-diamine.
| Compound Name | (Z)-1-N-(4-bromo-2-methoxyphenyl)but-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 153296304 |
| Molecular Formula | C11H15BrN2O |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | (Z)-1-N-(4-bromo-2-methoxyphenyl)but-1-ene-1,2-diamine |
| SMILES | CC/C(N)=C/Nc1ccc(Br)cc1OC |
| InChI | InChI=1S/C11H15BrN2O/c1-3-9(13)7-14-10-5-4-8(12)6-11(10)15-2/h4-7,14H,3,13H2,1-2H3/b9-7- |
| InChIKey | OQVYTCNFWKVAQI-CLFYSBASSA-N |
| XLogP | 3.08 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |