C14H15NO4 — CID 153300294
ethyl (Z)-3-[3,4-bis(hydroxymethyl)phenyl]-2-isocyanoprop-2-enoate (PubChem CID 153300294) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is ethyl (Z)-3-[3,4-bis(hydroxymethyl)phenyl]-2-isocyanoprop-2-enoate.
| Compound Name | ethyl (Z)-3-[3,4-bis(hydroxymethyl)phenyl]-2-isocyanoprop-2-enoate |
|---|---|
| PubChem CID | 153300294 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | ethyl (Z)-3-[3,4-bis(hydroxymethyl)phenyl]-2-isocyanoprop-2-enoate |
| SMILES | [C-]#[N+]/C(=C\c1ccc(CO)c(CO)c1)C(=O)OCC |
| InChI | InChI=1S/C14H15NO4/c1-3-19-14(18)13(15-2)7-10-4-5-11(8-16)12(6-10)9-17/h4-7,16-17H,3,8-9H2,1H3/b13-7- |
| InChIKey | SMEXXQCWUFPOOO-QPEQYQDCSA-N |
| XLogP | 1.49 |
| TPSA | 71.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|