C14H21F2N3O2 — CID 153302172
(6R)-6-ethyl-7-[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]-4,7-diazaspiro[2.5]octane-4-carbonyl fluoride (PubChem CID 153302172) has the molecular formula C14H21F2N3O2 and a molecular weight of 301.34 g/mol. Its IUPAC name is (6R)-6-ethyl-7-[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]-4,7-diazaspiro[2.5]octane-4-carbonyl fluoride.
| Compound Name | (6R)-6-ethyl-7-[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]-4,7-diazaspiro[2.5]octane-4-carbonyl fluoride |
|---|---|
| PubChem CID | 153302172 |
| Molecular Formula | C14H21F2N3O2 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | (6R)-6-ethyl-7-[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]-4,7-diazaspiro[2.5]octane-4-carbonyl fluoride |
| SMILES | CC[C@@H]1CN(C(=O)F)C2(CC2)CN1C(=O)[C@@H]1C[C@@H](F)CN1 |
| InChI | InChI=1S/C14H21F2N3O2/c1-2-10-7-19(13(16)21)14(3-4-14)8-18(10)12(20)11-5-9(15)6-17-11/h9-11,17H,2-8H2,1H3/t9-,10-,11+/m1/s1 |
| InChIKey | JXSDBVSOFRUCLQ-MXWKQRLJSA-N |
| XLogP | 1.23 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|