C67H45F3N4 — CID 153303040
2,6-bis[3,6-bis(4-methylphenyl)carbazol-9-yl]-4-[4-cyano-2-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 153303040) has the molecular formula C67H45F3N4 and a molecular weight of 963.12 g/mol. Its IUPAC name is 2,6-bis[3,6-bis(4-methylphenyl)carbazol-9-yl]-4-[4-cyano-2-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 2,6-bis[3,6-bis(4-methylphenyl)carbazol-9-yl]-4-[4-cyano-2-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 153303040 |
| Molecular Formula | C67H45F3N4 |
| Molecular Weight | 963.12 g/mol |
| Exact Mass | 962.36 |
| IUPAC Name | 2,6-bis[3,6-bis(4-methylphenyl)carbazol-9-yl]-4-[4-cyano-2-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | Cc1ccc(-c2ccc3c(c2)c2cc(-c4ccc(C)cc4)ccc2n3-c2cc(-c3ccc(C#N)cc3C(F)(F)F)cc(-n3c4ccc(-c5ccc(C)cc5)cc4c4cc(-c5ccc(C)cc5)ccc43)c2C#N)cc1 |
| InChI | InChI=1S/C67H45F3N4/c1-40-5-14-45(15-6-40)49-22-27-61-55(32-49)56-33-50(46-16-7-41(2)8-17-46)23-28-62(56)73(61)65-36-53(54-26-13-44(38-71)31-60(54)67(68,69)70)37-66(59(65)39-72)74-63-29-24-51(47-18-9-42(3)10-19-47)34-57(63)58-35-52(25-30-64(58)74)48-20-11-43(4)12-21-48/h5-37H,1-4H3 |
| InChIKey | ORSOPQKAZIDWEZ-UHFFFAOYSA-N |
| XLogP | 18.21 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.12 |
| LogP ≤ 5 | 18.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |