C17H32N2O12S — CID 153304834
N-(2-methylsulfanylethyl)-2-[[(3R,4R)-2,3,5,6-tetrahydroxy-4-[(2R,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexylidene]amino]oxyacetamide (PubChem CID 153304834) has the molecular formula C17H32N2O12S and a molecular weight of 488.51 g/mol. Its IUPAC name is N-(2-methylsulfanylethyl)-2-[[(3R,4R)-2,3,5,6-tetrahydroxy-4-[(2R,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexylidene]amino]oxyacetamide.
| Compound Name | N-(2-methylsulfanylethyl)-2-[[(3R,4R)-2,3,5,6-tetrahydroxy-4-[(2R,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexylidene]amino]oxyacetamide |
|---|---|
| PubChem CID | 153304834 |
| Molecular Formula | C17H32N2O12S |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | N-(2-methylsulfanylethyl)-2-[[(3R,4R)-2,3,5,6-tetrahydroxy-4-[(2R,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexylidene]amino]oxyacetamide |
| SMILES | CSCCNC(=O)CON=CC(O)[C@@H](O)[C@H](O[C@H]1OC(CO)[C@@H](O)[C@H](O)C1O)C(O)CO |
| InChI | InChI=1S/C17H32N2O12S/c1-32-3-2-18-11(24)7-29-19-4-8(22)12(25)16(9(23)5-20)31-17-15(28)14(27)13(26)10(6-21)30-17/h4,8-10,12-17,20-23,25-28H,2-3,5-7H2,1H3,(H,18,24)/t8?,9?,10?,12-,13-,14+,15?,16-,17-/m1/s1 |
| InChIKey | BQALKQNEIUCLMR-ZUSDUQMUSA-N |
| XLogP | -5.27 |
| TPSA | 230.99 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | -5.27 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|