C17H34N2O12 — CID 177418326
(2R,3R,4R,5S,6E)-6-[2-(3-aminopropoxy)ethoxyimino]-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,4,5-tetrol (PubChem CID 177418326) has the molecular formula C17H34N2O12 and a molecular weight of 458.46 g/mol. Its IUPAC name is (2R,3R,4R,5S,6E)-6-[2-(3-aminopropoxy)ethoxyimino]-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,4,5-tetrol.
| Compound Name | (2R,3R,4R,5S,6E)-6-[2-(3-aminopropoxy)ethoxyimino]-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 177418326 |
| Molecular Formula | C17H34N2O12 |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | (2R,3R,4R,5S,6E)-6-[2-(3-aminopropoxy)ethoxyimino]-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,4,5-tetrol |
| SMILES | NCCCOCCO/N=C/[C@H](O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@H](O)CO |
| InChI | InChI=1S/C17H34N2O12/c18-2-1-3-28-4-5-29-19-6-9(22)12(24)16(10(23)7-20)31-17-15(27)14(26)13(25)11(8-21)30-17/h6,9-17,20-27H,1-5,7-8,18H2/b19-6+/t9-,10+,11+,12+,13+,14-,15+,16+,17-/m0/s1 |
| InChIKey | FEHVFOLIFVCIRL-JVZLDZJUSA-N |
| XLogP | -5.39 |
| TPSA | 237.14 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | -5.39 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|