C17H32NO10+ — CID 176975896
cyclopentyl-[(4R)-2,3,5,6-tetrahydroxy-4-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexylidene]azanium (PubChem CID 176975896) has the molecular formula C17H32NO10+ and a molecular weight of 410.44 g/mol. Its IUPAC name is cyclopentyl-[(4R)-2,3,5,6-tetrahydroxy-4-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexylidene]azanium.
| Compound Name | cyclopentyl-[(4R)-2,3,5,6-tetrahydroxy-4-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexylidene]azanium |
|---|---|
| PubChem CID | 176975896 |
| Molecular Formula | C17H32NO10+ |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | cyclopentyl-[(4R)-2,3,5,6-tetrahydroxy-4-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexylidene]azanium |
| SMILES | OCC1O[C@@H](O[C@H](C(O)CO)C(O)C(O)/C=[NH+]/C2CCCC2)C(O)C(O)[C@H]1O |
| InChI | InChI=1S/C17H31NO10/c19-6-10(22)16(12(23)9(21)5-18-8-3-1-2-4-8)28-17-15(26)14(25)13(24)11(7-20)27-17/h5,8-17,19-26H,1-4,6-7H2/p+1/b18-5+/t9?,10?,11?,12?,13-,14?,15?,16+,17-/m0/s1 |
| InChIKey | ZYSADPVIEVMTEE-ILRNPQAVSA-O |
| XLogP | -5.66 |
| TPSA | 194.27 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | -5.66 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|