C17H31NO10 — CID 176975897
(3R)-6-cyclopentylimino-3-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,4,5-tetrol (PubChem CID 176975897) has the molecular formula C17H31NO10 and a molecular weight of 409.43 g/mol. Its IUPAC name is (3R)-6-cyclopentylimino-3-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,4,5-tetrol.
| Compound Name | (3R)-6-cyclopentylimino-3-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 176975897 |
| Molecular Formula | C17H31NO10 |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (3R)-6-cyclopentylimino-3-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,4,5-tetrol |
| SMILES | OCC1O[C@@H](O[C@H](C(O)CO)C(O)C(O)/C=N/C2CCCC2)C(O)C(O)[C@H]1O |
| InChI | InChI=1S/C17H31NO10/c19-6-10(22)16(12(23)9(21)5-18-8-3-1-2-4-8)28-17-15(26)14(25)13(24)11(7-20)27-17/h5,8-17,19-26H,1-4,6-7H2/b18-5+/t9?,10?,11?,12?,13-,14?,15?,16+,17-/m0/s1 |
| InChIKey | ZYSADPVIEVMTEE-ILRNPQAVSA-N |
| XLogP | -3.74 |
| TPSA | 192.66 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | -3.74 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|