C26H32N4OS — CID 153311012
N-[2-[4-(4-cyclobutylpiperazin-1-yl)phenyl]ethyl]-3,6-dimethylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 153311012) has the molecular formula C26H32N4OS and a molecular weight of 448.64 g/mol. Its IUPAC name is N-[2-[4-(4-cyclobutylpiperazin-1-yl)phenyl]ethyl]-3,6-dimethylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | N-[2-[4-(4-cyclobutylpiperazin-1-yl)phenyl]ethyl]-3,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 153311012 |
| Molecular Formula | C26H32N4OS |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | N-[2-[4-(4-cyclobutylpiperazin-1-yl)phenyl]ethyl]-3,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1ccc2c(C)c(C(=O)NCCc3ccc(N4CCN(C5CCC5)CC4)cc3)sc2n1 |
| InChI | InChI=1S/C26H32N4OS/c1-18-6-11-23-19(2)24(32-26(23)28-18)25(31)27-13-12-20-7-9-22(10-8-20)30-16-14-29(15-17-30)21-4-3-5-21/h6-11,21H,3-5,12-17H2,1-2H3,(H,27,31) |
| InChIKey | QXNRYMPCGJTVMJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|