C22H27N5OS — CID 157222940
3-amino-6-(methylamino)-N-[2-(4-piperidin-1-ylphenyl)ethyl]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 157222940) has the molecular formula C22H27N5OS and a molecular weight of 409.56 g/mol. Its IUPAC name is 3-amino-6-(methylamino)-N-[2-(4-piperidin-1-ylphenyl)ethyl]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-6-(methylamino)-N-[2-(4-piperidin-1-ylphenyl)ethyl]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 157222940 |
| Molecular Formula | C22H27N5OS |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 3-amino-6-(methylamino)-N-[2-(4-piperidin-1-ylphenyl)ethyl]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CNc1ccc2c(N)c(C(=O)NCCc3ccc(N4CCCCC4)cc3)sc2n1 |
| InChI | InChI=1S/C22H27N5OS/c1-24-18-10-9-17-19(23)20(29-22(17)26-18)21(28)25-12-11-15-5-7-16(8-6-15)27-13-3-2-4-14-27/h5-10H,2-4,11-14,23H2,1H3,(H,24,26)(H,25,28) |
| InChIKey | MGKMPKIQZCFJLP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|