C21H28N6OS — CID 167148202
[3-amino-6-(methylamino)thieno[2,3-b]pyridin-2-yl]-[2-(4-piperazin-1-ylphenyl)ethylamino]methanol (PubChem CID 167148202) has the molecular formula C21H28N6OS and a molecular weight of 412.56 g/mol. Its IUPAC name is [3-amino-6-(methylamino)thieno[2,3-b]pyridin-2-yl]-[2-(4-piperazin-1-ylphenyl)ethylamino]methanol.
| Compound Name | [3-amino-6-(methylamino)thieno[2,3-b]pyridin-2-yl]-[2-(4-piperazin-1-ylphenyl)ethylamino]methanol |
|---|---|
| PubChem CID | 167148202 |
| Molecular Formula | C21H28N6OS |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | [3-amino-6-(methylamino)thieno[2,3-b]pyridin-2-yl]-[2-(4-piperazin-1-ylphenyl)ethylamino]methanol |
| SMILES | CNc1ccc2c(N)c(C(O)NCCc3ccc(N4CCNCC4)cc3)sc2n1 |
| InChI | InChI=1S/C21H28N6OS/c1-23-17-7-6-16-18(22)19(29-21(16)26-17)20(28)25-9-8-14-2-4-15(5-3-14)27-12-10-24-11-13-27/h2-7,20,24-25,28H,8-13,22H2,1H3,(H,23,26) |
| InChIKey | WMMGBQHDCRATTB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|