C24H45N3O7 — CID 153311374
(6R,7S,8S,9R,10R,12R)-9-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-7,10-dihydroxy-1,6,8,10,12-pentamethyl-1,4-diazacyclotridecane-2,5-dione (PubChem CID 153311374) has the molecular formula C24H45N3O7 and a molecular weight of 487.64 g/mol. Its IUPAC name is (6R,7S,8S,9R,10R,12R)-9-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-7,10-dihydroxy-1,6,8,10,12-pentamethyl-1,4-diazacyclotridecane-2,5-dione.
| Compound Name | (6R,7S,8S,9R,10R,12R)-9-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-7,10-dihydroxy-1,6,8,10,12-pentamethyl-1,4-diazacyclotridecane-2,5-dione |
|---|---|
| PubChem CID | 153311374 |
| Molecular Formula | C24H45N3O7 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.33 |
| IUPAC Name | (6R,7S,8S,9R,10R,12R)-9-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-7,10-dihydroxy-1,6,8,10,12-pentamethyl-1,4-diazacyclotridecane-2,5-dione |
| SMILES | C[C@H]1CN(C)C(=O)CNC(=O)[C@H](C)[C@@H](O)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@H](N(C)C)[C@H]2O)[C@](C)(O)C1 |
| InChI | InChI=1S/C24H45N3O7/c1-13-10-24(5,32)21(34-23-20(30)17(26(6)7)9-14(2)33-23)15(3)19(29)16(4)22(31)25-11-18(28)27(8)12-13/h13-17,19-21,23,29-30,32H,9-12H2,1-8H3,(H,25,31)/t13-,14-,15+,16-,17+,19+,20-,21-,23+,24-/m1/s1 |
| InChIKey | VRODRPBHLSLZLK-FNCUTBLWSA-N |
| XLogP | -0.20 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |