C26H47N3O6 — CID 156561136
(1R,2R,10R,13R,14R)-13-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-1-hydroxy-2,8,10,12,14-pentamethyl-4,8-diazabicyclo[10.2.1]pentadecane-3,7-dione (PubChem CID 156561136) has the molecular formula C26H47N3O6 and a molecular weight of 497.68 g/mol. Its IUPAC name is (1R,2R,10R,13R,14R)-13-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-1-hydroxy-2,8,10,12,14-pentamethyl-4,8-diazabicyclo[10.2.1]pentadecane-3,7-dione.
| Compound Name | (1R,2R,10R,13R,14R)-13-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-1-hydroxy-2,8,10,12,14-pentamethyl-4,8-diazabicyclo[10.2.1]pentadecane-3,7-dione |
|---|---|
| PubChem CID | 156561136 |
| Molecular Formula | C26H47N3O6 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.35 |
| IUPAC Name | (1R,2R,10R,13R,14R)-13-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-1-hydroxy-2,8,10,12,14-pentamethyl-4,8-diazabicyclo[10.2.1]pentadecane-3,7-dione |
| SMILES | C[C@H]1CN(C)C(=O)CCNC(=O)[C@H](C)[C@@]2(O)CC(C)(C1)[C@H](O[C@@H]1O[C@H](C)C[C@H](N(C)C)[C@H]1O)[C@H]2C |
| InChI | InChI=1S/C26H47N3O6/c1-15-12-25(5)14-26(33,18(4)23(32)27-10-9-20(30)29(8)13-15)17(3)22(25)35-24-21(31)19(28(6)7)11-16(2)34-24/h15-19,21-22,24,31,33H,9-14H2,1-8H3,(H,27,32)/t15-,16-,17-,18+,19+,21-,22-,24+,25?,26-/m1/s1 |
| InChIKey | RTBKRDPMPVDYAB-GEWGJTJESA-N |
| XLogP | 1.22 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |