C27H50N2O5 — CID 67820307
11-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-2,4,8,10,12,14-hexamethyl-15-oxa-6-azabicyclo[10.2.1]pentadecan-7-one (PubChem CID 67820307) has the molecular formula C27H50N2O5 and a molecular weight of 482.71 g/mol. Its IUPAC name is 11-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-2,4,8,10,12,14-hexamethyl-15-oxa-6-azabicyclo[10.2.1]pentadecan-7-one.
| Compound Name | 11-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-2,4,8,10,12,14-hexamethyl-15-oxa-6-azabicyclo[10.2.1]pentadecan-7-one |
|---|---|
| PubChem CID | 67820307 |
| Molecular Formula | C27H50N2O5 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.37 |
| IUPAC Name | 11-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-2,4,8,10,12,14-hexamethyl-15-oxa-6-azabicyclo[10.2.1]pentadecan-7-one |
| SMILES | CC1CNC(=O)C(C)CC(C)C(O[C@@H]2O[C@H](C)C[C@H](N(C)C)[C@H]2O)C2(C)CC(C)C(O2)C(C)C1 |
| InChI | InChI=1S/C27H50N2O5/c1-15-10-16(2)23-19(5)13-27(7,34-23)24(17(3)11-18(4)25(31)28-14-15)33-26-22(30)21(29(8)9)12-20(6)32-26/h15-24,26,30H,10-14H2,1-9H3,(H,28,31)/t15?,16?,17?,18?,19?,20-,21+,22-,23?,24?,26+,27?/m1/s1 |
| InChIKey | LGVGZJOPESKNEE-KONKHDTDSA-N |
| XLogP | 3.44 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |