C25H46N2O8 — CID 167414537
(3R,6R,8R,9R,10R,12R)-9-[(2S)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-3-(hydroxymethyl)-8-methoxy-6,8,10,12-tetramethyl-1-oxa-4-azacyclotridecane-11,13-dione (PubChem CID 167414537) has the molecular formula C25H46N2O8 and a molecular weight of 502.65 g/mol. Its IUPAC name is (3R,6R,8R,9R,10R,12R)-9-[(2S)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-3-(hydroxymethyl)-8-methoxy-6,8,10,12-tetramethyl-1-oxa-4-azacyclotridecane-11,13-dione.
| Compound Name | (3R,6R,8R,9R,10R,12R)-9-[(2S)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-3-(hydroxymethyl)-8-methoxy-6,8,10,12-tetramethyl-1-oxa-4-azacyclotridecane-11,13-dione |
|---|---|
| PubChem CID | 167414537 |
| Molecular Formula | C25H46N2O8 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | (3R,6R,8R,9R,10R,12R)-9-[(2S)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-3-(hydroxymethyl)-8-methoxy-6,8,10,12-tetramethyl-1-oxa-4-azacyclotridecane-11,13-dione |
| SMILES | CO[C@]1(C)C[C@@H](C)CN[C@H](CO)COC(=O)[C@H](C)C(=O)[C@H](C)[C@H]1O[C@@H]1OC(C)CC(N(C)C)C1O |
| InChI | InChI=1S/C25H46N2O8/c1-14-10-25(5,32-8)22(35-24-21(30)19(27(6)7)9-15(2)34-24)16(3)20(29)17(4)23(31)33-13-18(12-28)26-11-14/h14-19,21-22,24,26,28,30H,9-13H2,1-8H3/t14-,15?,16+,17-,18-,19?,21?,22-,24+,25-/m1/s1 |
| InChIKey | WKMIVPWXAQBZKR-RNZQCNEUSA-N |
| XLogP | 0.58 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|