C31H49NO7 — CID 165017296
(3R,5R,6R,7R,9S,12R)-6-[(2S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-7-methoxy-3,5,7,9-tetramethyl-12-phenyl-oxacyclotridecane-2,4-dione (PubChem CID 165017296) has the molecular formula C31H49NO7 and a molecular weight of 547.73 g/mol. Its IUPAC name is (3R,5R,6R,7R,9S,12R)-6-[(2S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-7-methoxy-3,5,7,9-tetramethyl-12-phenyl-oxacyclotridecane-2,4-dione.
| Compound Name | (3R,5R,6R,7R,9S,12R)-6-[(2S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-7-methoxy-3,5,7,9-tetramethyl-12-phenyl-oxacyclotridecane-2,4-dione |
|---|---|
| PubChem CID | 165017296 |
| Molecular Formula | C31H49NO7 |
| Molecular Weight | 547.73 g/mol |
| Exact Mass | 547.35 |
| IUPAC Name | (3R,5R,6R,7R,9S,12R)-6-[(2S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-7-methoxy-3,5,7,9-tetramethyl-12-phenyl-oxacyclotridecane-2,4-dione |
| SMILES | CO[C@]1(C)C[C@@H](C)CC[C@H](c2ccccc2)COC(=O)[C@H](C)C(=O)[C@H](C)[C@H]1O[C@@H]1O[C@H](C)CC(N(C)C)C1O |
| InChI | InChI=1S/C31H49NO7/c1-19-14-15-24(23-12-10-9-11-13-23)18-37-29(35)22(4)26(33)21(3)28(31(5,17-19)36-8)39-30-27(34)25(32(6)7)16-20(2)38-30/h9-13,19-22,24-25,27-28,30,34H,14-18H2,1-8H3/t19-,20+,21-,22+,24-,25?,27?,28+,30-,31+/m0/s1 |
| InChIKey | KPTOTCKAKOPWES-IRARBBPDSA-N |
| XLogP | 4.19 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.73 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|