C25H46N2O7 — CID 167414566
(3R,6R,8R,9R,10R,12R)-9-[(2S)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-3,6,8,10,12-pentamethyl-1-oxa-4-azacyclotridecane-11,13-dione (PubChem CID 167414566) has the molecular formula C25H46N2O7 and a molecular weight of 486.65 g/mol. Its IUPAC name is (3R,6R,8R,9R,10R,12R)-9-[(2S)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-3,6,8,10,12-pentamethyl-1-oxa-4-azacyclotridecane-11,13-dione.
| Compound Name | (3R,6R,8R,9R,10R,12R)-9-[(2S)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-3,6,8,10,12-pentamethyl-1-oxa-4-azacyclotridecane-11,13-dione |
|---|---|
| PubChem CID | 167414566 |
| Molecular Formula | C25H46N2O7 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | (3R,6R,8R,9R,10R,12R)-9-[(2S)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-3,6,8,10,12-pentamethyl-1-oxa-4-azacyclotridecane-11,13-dione |
| SMILES | CO[C@]1(C)C[C@@H](C)CN[C@H](C)COC(=O)[C@H](C)C(=O)[C@H](C)[C@H]1O[C@@H]1OC(C)CC(N(C)C)C1O |
| InChI | InChI=1S/C25H46N2O7/c1-14-11-25(6,31-9)22(34-24-21(29)19(27(7)8)10-16(3)33-24)17(4)20(28)18(5)23(30)32-13-15(2)26-12-14/h14-19,21-22,24,26,29H,10-13H2,1-9H3/t14-,15-,16?,17+,18-,19?,21?,22-,24+,25-/m1/s1 |
| InChIKey | QKZOZBHYMDLDTQ-UWBLIALESA-N |
| XLogP | 1.61 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|