C27H50N2O8S — CID 167414471
(3R,6R,8R,9R,10R,12R)-9-[(2S)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-6,8,10,12-tetramethyl-3-(2-methylsulfinylethyl)-1-oxa-4-azacyclotridecane-11,13-dione (PubChem CID 167414471) has the molecular formula C27H50N2O8S and a molecular weight of 562.77 g/mol. Its IUPAC name is (3R,6R,8R,9R,10R,12R)-9-[(2S)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-6,8,10,12-tetramethyl-3-(2-methylsulfinylethyl)-1-oxa-4-azacyclotridecane-11,13-dione.
| Compound Name | (3R,6R,8R,9R,10R,12R)-9-[(2S)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-6,8,10,12-tetramethyl-3-(2-methylsulfinylethyl)-1-oxa-4-azacyclotridecane-11,13-dione |
|---|---|
| PubChem CID | 167414471 |
| Molecular Formula | C27H50N2O8S |
| Molecular Weight | 562.77 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | (3R,6R,8R,9R,10R,12R)-9-[(2S)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-8-methoxy-6,8,10,12-tetramethyl-3-(2-methylsulfinylethyl)-1-oxa-4-azacyclotridecane-11,13-dione |
| SMILES | CO[C@]1(C)C[C@@H](C)CN[C@H](CCS(C)=O)COC(=O)[C@H](C)C(=O)[C@H](C)[C@H]1O[C@@H]1OC(C)CC(N(C)C)C1O |
| InChI | InChI=1S/C27H50N2O8S/c1-16-13-27(5,34-8)24(37-26-23(31)21(29(6)7)12-17(2)36-26)18(3)22(30)19(4)25(32)35-15-20(28-14-16)10-11-38(9)33/h16-21,23-24,26,28,31H,10-15H2,1-9H3/t16-,17?,18+,19-,20-,21?,23?,24-,26+,27-,38?/m1/s1 |
| InChIKey | XUQGQNNNIIOIPB-DQADIZMBSA-N |
| XLogP | 1.35 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.77 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|