C28H51N3O7 — CID 175971672
(7R)-10-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-9-methoxy-2,5,7,9,11,13-hexamethyl-15-oxa-2,5-diazaspiro[3.12]hexadecane-12,14-dione (PubChem CID 175971672) has the molecular formula C28H51N3O7 and a molecular weight of 541.73 g/mol. Its IUPAC name is (7R)-10-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-9-methoxy-2,5,7,9,11,13-hexamethyl-15-oxa-2,5-diazaspiro[3.12]hexadecane-12,14-dione.
| Compound Name | (7R)-10-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-9-methoxy-2,5,7,9,11,13-hexamethyl-15-oxa-2,5-diazaspiro[3.12]hexadecane-12,14-dione |
|---|---|
| PubChem CID | 175971672 |
| Molecular Formula | C28H51N3O7 |
| Molecular Weight | 541.73 g/mol |
| Exact Mass | 541.37 |
| IUPAC Name | (7R)-10-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-9-methoxy-2,5,7,9,11,13-hexamethyl-15-oxa-2,5-diazaspiro[3.12]hexadecane-12,14-dione |
| SMILES | COC1(C)C[C@@H](C)CN(C)C2(COC(=O)C(C)C(=O)C(C)C1O[C@@H]1O[C@H](C)C[C@H](N(C)C)[C@H]1O)CN(C)C2 |
| InChI | InChI=1S/C28H51N3O7/c1-17-12-27(5,35-10)24(38-26-23(33)21(29(6)7)11-18(2)37-26)19(3)22(32)20(4)25(34)36-16-28(31(9)13-17)14-30(8)15-28/h17-21,23-24,26,33H,11-16H2,1-10H3/t17-,18-,19?,20?,21+,23-,24?,26+,27?/m1/s1 |
| InChIKey | PEGODZFQSJCPCE-HGGSSVBMSA-N |
| XLogP | 1.24 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.73 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|