C16H19BrFN3O2 — CID 153314510
tert-butyl N-[3-(5-bromo-3-fluoro-2-pyridinyl)-3-cyano-1-methylcyclobutyl]carbamate (PubChem CID 153314510) has the molecular formula C16H19BrFN3O2 and a molecular weight of 384.25 g/mol. Its IUPAC name is tert-butyl N-[3-(5-bromo-3-fluoro-2-pyridinyl)-3-cyano-1-methylcyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-(5-bromo-3-fluoro-2-pyridinyl)-3-cyano-1-methylcyclobutyl]carbamate |
|---|---|
| PubChem CID | 153314510 |
| Molecular Formula | C16H19BrFN3O2 |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | tert-butyl N-[3-(5-bromo-3-fluoro-2-pyridinyl)-3-cyano-1-methylcyclobutyl]carbamate |
| SMILES | CC1(NC(=O)OC(C)(C)C)CC(C#N)(c2ncc(Br)cc2F)C1 |
| InChI | InChI=1S/C16H19BrFN3O2/c1-14(2,3)23-13(22)21-15(4)7-16(8-15,9-19)12-11(18)5-10(17)6-20-12/h5-6H,7-8H2,1-4H3,(H,21,22) |
| InChIKey | ALAIKEIZXNZZRP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |