C16H32N2O6 — CID 153316173
2-ethoxyethyl N-[6-(2-ethoxyethoxycarbonylamino)hexan-2-yl]carbamate (PubChem CID 153316173) has the molecular formula C16H32N2O6 and a molecular weight of 348.44 g/mol. Its IUPAC name is 2-ethoxyethyl N-[6-(2-ethoxyethoxycarbonylamino)hexan-2-yl]carbamate.
| Compound Name | 2-ethoxyethyl N-[6-(2-ethoxyethoxycarbonylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 153316173 |
| Molecular Formula | C16H32N2O6 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 2-ethoxyethyl N-[6-(2-ethoxyethoxycarbonylamino)hexan-2-yl]carbamate |
| SMILES | CCOCCOC(=O)NCCCCC(C)NC(=O)OCCOCC |
| InChI | InChI=1S/C16H32N2O6/c1-4-21-10-12-23-15(19)17-9-7-6-8-14(3)18-16(20)24-13-11-22-5-2/h14H,4-13H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | PJKWVPLEGFTUKS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|