C13H22OSi — CID 153318145
trimethyl-[(3-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)oxy]silane (PubChem CID 153318145) has the molecular formula C13H22OSi and a molecular weight of 222.40 g/mol. Its IUPAC name is trimethyl-[(3-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)oxy]silane.
| Compound Name | trimethyl-[(3-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)oxy]silane |
|---|---|
| PubChem CID | 153318145 |
| Molecular Formula | C13H22OSi |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | trimethyl-[(3-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)oxy]silane |
| SMILES | CC1CC(O[Si](C)(C)C)C2C=CC=CC12 |
| InChI | InChI=1S/C13H22OSi/c1-10-9-13(14-15(2,3)4)12-8-6-5-7-11(10)12/h5-8,10-13H,9H2,1-4H3 |
| InChIKey | FRXDHAISGIYLTO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|