C19H32OSi — CID 58630455
2,3,3a,7a-tetrahydro-1H-inden-2-yloxy-but-3-enyl-di(propan-2-yl)silane (PubChem CID 58630455) has the molecular formula C19H32OSi and a molecular weight of 304.55 g/mol. Its IUPAC name is 2,3,3a,7a-tetrahydro-1H-inden-2-yloxy-but-3-enyl-di(propan-2-yl)silane.
| Compound Name | 2,3,3a,7a-tetrahydro-1H-inden-2-yloxy-but-3-enyl-di(propan-2-yl)silane |
|---|---|
| PubChem CID | 58630455 |
| Molecular Formula | C19H32OSi |
| Molecular Weight | 304.55 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 2,3,3a,7a-tetrahydro-1H-inden-2-yloxy-but-3-enyl-di(propan-2-yl)silane |
| SMILES | C=CCC[Si](OC1CC2C=CC=CC2C1)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H32OSi/c1-6-7-12-21(15(2)3,16(4)5)20-19-13-17-10-8-9-11-18(17)14-19/h6,8-11,15-19H,1,7,12-14H2,2-5H3 |
| InChIKey | ZCOXDDVMOSPDBN-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|