C15H28O2Si2 — CID 6427270
trimethyl-[[(1R,2R)-1-trimethylsilyloxy-2,3,3a,7a-tetrahydro-1H-inden-2-yl]oxy]silane (PubChem CID 6427270) has the molecular formula C15H28O2Si2 and a molecular weight of 296.56 g/mol. Its IUPAC name is trimethyl-[[(1R,2R)-1-trimethylsilyloxy-2,3,3a,7a-tetrahydro-1H-inden-2-yl]oxy]silane.
| Compound Name | trimethyl-[[(1R,2R)-1-trimethylsilyloxy-2,3,3a,7a-tetrahydro-1H-inden-2-yl]oxy]silane |
|---|---|
| PubChem CID | 6427270 |
| Molecular Formula | C15H28O2Si2 |
| Molecular Weight | 296.56 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | trimethyl-[[(1R,2R)-1-trimethylsilyloxy-2,3,3a,7a-tetrahydro-1H-inden-2-yl]oxy]silane |
| SMILES | C[Si](C)(C)O[C@@H]1C2C=CC=CC2C[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C15H28O2Si2/c1-18(2,3)16-14-11-12-9-7-8-10-13(12)15(14)17-19(4,5)6/h7-10,12-15H,11H2,1-6H3/t12?,13?,14-,15-/m1/s1 |
| InChIKey | QROYLCXJVWVTEI-NEXFUWMNSA-N |
| XLogP | 4.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|