C17H30OSi — CID 153243261
tert-butyl-[(3-ethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)oxy]-dimethylsilane (PubChem CID 153243261) has the molecular formula C17H30OSi and a molecular weight of 278.51 g/mol. Its IUPAC name is tert-butyl-[(3-ethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)oxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3-ethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)oxy]-dimethylsilane |
|---|---|
| PubChem CID | 153243261 |
| Molecular Formula | C17H30OSi |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | tert-butyl-[(3-ethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)oxy]-dimethylsilane |
| SMILES | CCC1CC(O[Si](C)(C)C(C)(C)C)C2C=CC=CC12 |
| InChI | InChI=1S/C17H30OSi/c1-7-13-12-16(15-11-9-8-10-14(13)15)18-19(5,6)17(2,3)4/h8-11,13-16H,7,12H2,1-6H3 |
| InChIKey | WRWFOGDDXFILQD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|