C15H26OSi — CID 59879659
2,3,3a,7a-tetrahydro-1H-inden-1-yloxy-tert-butyl-dimethylsilane (PubChem CID 59879659) has the molecular formula C15H26OSi and a molecular weight of 250.46 g/mol. Its IUPAC name is 2,3,3a,7a-tetrahydro-1H-inden-1-yloxy-tert-butyl-dimethylsilane.
| Compound Name | 2,3,3a,7a-tetrahydro-1H-inden-1-yloxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 59879659 |
| Molecular Formula | C15H26OSi |
| Molecular Weight | 250.46 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 2,3,3a,7a-tetrahydro-1H-inden-1-yloxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC2C=CC=CC21 |
| InChI | InChI=1S/C15H26OSi/c1-15(2,3)17(4,5)16-14-11-10-12-8-6-7-9-13(12)14/h6-9,12-14H,10-11H2,1-5H3 |
| InChIKey | CCRGLBHFTBEWOV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|