C33H21N3O — CID 153320384
5-[2-(4-isocyanophenoxy)phenyl]-6-phenylindolo[2,3-b]indole (PubChem CID 153320384) has the molecular formula C33H21N3O and a molecular weight of 475.55 g/mol. Its IUPAC name is 5-[2-(4-isocyanophenoxy)phenyl]-6-phenylindolo[2,3-b]indole.
| Compound Name | 5-[2-(4-isocyanophenoxy)phenyl]-6-phenylindolo[2,3-b]indole |
|---|---|
| PubChem CID | 153320384 |
| Molecular Formula | C33H21N3O |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 5-[2-(4-isocyanophenoxy)phenyl]-6-phenylindolo[2,3-b]indole |
| SMILES | [C-]#[N+]c1ccc(Oc2ccccc2-n2c3ccccc3c3c4ccccc4n(-c4ccccc4)c32)cc1 |
| InChI | InChI=1S/C33H21N3O/c1-34-23-19-21-25(22-20-23)37-31-18-10-9-17-30(31)36-29-16-8-6-14-27(29)32-26-13-5-7-15-28(26)35(33(32)36)24-11-3-2-4-12-24/h2-22H |
| InChIKey | OUCZIBVJBORJCI-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 23.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|