C11H14N2 — CID 153321398
(1R,6S)-6-pyridin-2-yl-3-azabicyclo[4.1.0]heptane (PubChem CID 153321398) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is (1R,6S)-6-pyridin-2-yl-3-azabicyclo[4.1.0]heptane.
| Compound Name | (1R,6S)-6-pyridin-2-yl-3-azabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 153321398 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (1R,6S)-6-pyridin-2-yl-3-azabicyclo[4.1.0]heptane |
| SMILES | c1ccc([C@@]23CCNC[C@@H]2C3)nc1 |
| InChI | InChI=1S/C11H14N2/c1-2-5-13-10(3-1)11-4-6-12-8-9(11)7-11/h1-3,5,9,12H,4,6-8H2/t9-,11+/m0/s1 |
| InChIKey | AQCUXHRAXPCCHP-GXSJLCMTSA-N |
| XLogP | 1.33 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |