C18H24BrN3O4S — CID 153321484
tert-butyl N-[3-(6-bromo-3-methylsulfonylpyrrolo[2,3-b]pyridin-1-yl)cyclobutyl]-N-methylcarbamate (PubChem CID 153321484) has the molecular formula C18H24BrN3O4S and a molecular weight of 458.38 g/mol. Its IUPAC name is tert-butyl N-[3-(6-bromo-3-methylsulfonylpyrrolo[2,3-b]pyridin-1-yl)cyclobutyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-(6-bromo-3-methylsulfonylpyrrolo[2,3-b]pyridin-1-yl)cyclobutyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 153321484 |
| Molecular Formula | C18H24BrN3O4S |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | tert-butyl N-[3-(6-bromo-3-methylsulfonylpyrrolo[2,3-b]pyridin-1-yl)cyclobutyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CC(n2cc(S(C)(=O)=O)c3ccc(Br)nc32)C1 |
| InChI | InChI=1S/C18H24BrN3O4S/c1-18(2,3)26-17(23)21(4)11-8-12(9-11)22-10-14(27(5,24)25)13-6-7-15(19)20-16(13)22/h6-7,10-12H,8-9H2,1-5H3 |
| InChIKey | ZZXSIMCSLODXLN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|