C15H19BClF2N3O2 — CID 153321487
4-chloro-1-(1,1-difluoroethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-3-amine (PubChem CID 153321487) has the molecular formula C15H19BClF2N3O2 and a molecular weight of 357.60 g/mol. Its IUPAC name is 4-chloro-1-(1,1-difluoroethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-3-amine.
| Compound Name | 4-chloro-1-(1,1-difluoroethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-3-amine |
|---|---|
| PubChem CID | 153321487 |
| Molecular Formula | C15H19BClF2N3O2 |
| Molecular Weight | 357.60 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 4-chloro-1-(1,1-difluoroethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-3-amine |
| SMILES | CC(F)(F)n1nc(N)c2c(Cl)ccc(B3OC(C)(C)C(C)(C)O3)c21 |
| InChI | InChI=1S/C15H19BClF2N3O2/c1-13(2)14(3,4)24-16(23-13)8-6-7-9(17)10-11(8)22(15(5,18)19)21-12(10)20/h6-7H,1-5H3,(H2,20,21) |
| InChIKey | XZBXYWYNYPFCLD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.60 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|