C15H21BClN3O3S — CID 144668105
N-[4-chloro-1-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-3-yl]methanesulfinamide (PubChem CID 144668105) has the molecular formula C15H21BClN3O3S and a molecular weight of 369.68 g/mol. Its IUPAC name is N-[4-chloro-1-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-3-yl]methanesulfinamide.
| Compound Name | N-[4-chloro-1-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-3-yl]methanesulfinamide |
|---|---|
| PubChem CID | 144668105 |
| Molecular Formula | C15H21BClN3O3S |
| Molecular Weight | 369.68 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N-[4-chloro-1-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-3-yl]methanesulfinamide |
| SMILES | Cn1nc(NS(C)=O)c2c(Cl)ccc(B3OC(C)(C)C(C)(C)O3)c21 |
| InChI | InChI=1S/C15H21BClN3O3S/c1-14(2)15(3,4)23-16(22-14)9-7-8-10(17)11-12(9)20(5)18-13(11)19-24(6)21/h7-8H,1-6H3,(H,18,19) |
| InChIKey | JBXNCXKDAOWIIY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.68 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|