C17H24BClN2O2 — CID 166027283
2-tert-butyl-4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 166027283) has the molecular formula C17H24BClN2O2 and a molecular weight of 334.66 g/mol. Its IUPAC name is 2-tert-butyl-4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 2-tert-butyl-4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 166027283 |
| Molecular Formula | C17H24BClN2O2 |
| Molecular Weight | 334.66 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2-tert-butyl-4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | CC(C)(C)n1cc2c(Cl)c(B3OC(C)(C)C(C)(C)O3)ccc2n1 |
| InChI | InChI=1S/C17H24BClN2O2/c1-15(2,3)21-10-11-13(20-21)9-8-12(14(11)19)18-22-16(4,5)17(6,7)23-18/h8-10H,1-7H3 |
| InChIKey | KOCLUWUUQHRYFJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.66 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|