C34H44B2Cl2N4O8 — CID 159438689
tert-butyl 2-[4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]acetate;2-[4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]acetic acid (PubChem CID 159438689) has the molecular formula C34H44B2Cl2N4O8 and a molecular weight of 729.28 g/mol. Its IUPAC name is tert-butyl 2-[4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]acetate;2-[4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]acetic acid.
| Compound Name | tert-butyl 2-[4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]acetate;2-[4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]acetic acid |
|---|---|
| PubChem CID | 159438689 |
| Molecular Formula | C34H44B2Cl2N4O8 |
| Molecular Weight | 729.28 g/mol |
| Exact Mass | 728.27 |
| IUPAC Name | tert-butyl 2-[4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]acetate;2-[4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]acetic acid |
| SMILES | CC(C)(C)OC(=O)Cn1cc2c(Cl)c(B3OC(C)(C)C(C)(C)O3)ccc2n1.CC1(C)OB(c2ccc3nn(CC(=O)O)cc3c2Cl)OC1(C)C |
| InChI | InChI=1S/C19H26BClN2O4.C15H18BClN2O4/c1-17(2,3)25-15(24)11-23-10-12-14(22-23)9-8-13(16(12)21)20-26-18(4,5)19(6,7)27-20;1-14(2)15(3,4)23-16(22-14)10-5-6-11-9(13(10)17)7-19(18-11)8-12(20)21/h8-10H,11H2,1-7H3;5-7H,8H2,1-4H3,(H,20,21) |
| InChIKey | LRWZNFMOEGQEQQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 136.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.28 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|