C22H31BN2O4 — CID 166473870
tert-butyl 2-[3-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazol-1-yl]acetate (PubChem CID 166473870) has the molecular formula C22H31BN2O4 and a molecular weight of 398.31 g/mol. Its IUPAC name is tert-butyl 2-[3-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazol-1-yl]acetate.
| Compound Name | tert-butyl 2-[3-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 166473870 |
| Molecular Formula | C22H31BN2O4 |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | tert-butyl 2-[3-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazol-1-yl]acetate |
| SMILES | Cc1nn(CC(=O)OC(C)(C)C)cc1-c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C22H31BN2O4/c1-15-18(13-25(24-15)14-19(26)27-20(2,3)4)16-9-11-17(12-10-16)23-28-21(5,6)22(7,8)29-23/h9-13H,14H2,1-8H3 |
| InChIKey | IXKUWYYSZWIIKR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|