C23H35BN2O4 — CID 166474166
1-[2-methoxy-2-[(2-methylpropan-2-yl)oxy]ethyl]-3-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole (PubChem CID 166474166) has the molecular formula C23H35BN2O4 and a molecular weight of 414.36 g/mol. Its IUPAC name is 1-[2-methoxy-2-[(2-methylpropan-2-yl)oxy]ethyl]-3-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole.
| Compound Name | 1-[2-methoxy-2-[(2-methylpropan-2-yl)oxy]ethyl]-3-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole |
|---|---|
| PubChem CID | 166474166 |
| Molecular Formula | C23H35BN2O4 |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | 1-[2-methoxy-2-[(2-methylpropan-2-yl)oxy]ethyl]-3-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole |
| SMILES | COC(Cn1cc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)c(C)n1)OC(C)(C)C |
| InChI | InChI=1S/C23H35BN2O4/c1-16-19(14-26(25-16)15-20(27-9)28-21(2,3)4)17-10-12-18(13-11-17)24-29-22(5,6)23(7,8)30-24/h10-14,20H,15H2,1-9H3 |
| InChIKey | PQIUDBCSAIVUCD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|