C22H22BBrCl2F2N4O2 — CID 160825261
5-bromo-4-chloro-7-fluoro-2-methylindazole;4-chloro-7-fluoro-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 160825261) has the molecular formula C22H22BBrCl2F2N4O2 and a molecular weight of 574.06 g/mol. Its IUPAC name is 5-bromo-4-chloro-7-fluoro-2-methylindazole;4-chloro-7-fluoro-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 5-bromo-4-chloro-7-fluoro-2-methylindazole;4-chloro-7-fluoro-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 160825261 |
| Molecular Formula | C22H22BBrCl2F2N4O2 |
| Molecular Weight | 574.06 g/mol |
| Exact Mass | 572.04 |
| IUPAC Name | 5-bromo-4-chloro-7-fluoro-2-methylindazole;4-chloro-7-fluoro-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | Cn1cc2c(Cl)c(B3OC(C)(C)C(C)(C)O3)cc(F)c2n1.Cn1cc2c(Cl)c(Br)cc(F)c2n1 |
| InChI | InChI=1S/C14H17BClFN2O2.C8H5BrClFN2/c1-13(2)14(3,4)21-15(20-13)9-6-10(17)12-8(11(9)16)7-19(5)18-12;1-13-3-4-7(10)5(9)2-6(11)8(4)12-13/h6-7H,1-5H3;2-3H,1H3 |
| InChIKey | SGBOPJPNSJUFHZ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.06 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|