C11H14BrFN2 — CID 178051017
5-bromo-4-fluoro-2,7-dimethylindazole;ethane (PubChem CID 178051017) has the molecular formula C11H14BrFN2 and a molecular weight of 273.15 g/mol. Its IUPAC name is 5-bromo-4-fluoro-2,7-dimethylindazole;ethane.
| Compound Name | 5-bromo-4-fluoro-2,7-dimethylindazole;ethane |
|---|---|
| PubChem CID | 178051017 |
| Molecular Formula | C11H14BrFN2 |
| Molecular Weight | 273.15 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 5-bromo-4-fluoro-2,7-dimethylindazole;ethane |
| SMILES | CC.Cc1cc(Br)c(F)c2cn(C)nc12 |
| InChI | InChI=1S/C9H8BrFN2.C2H6/c1-5-3-7(10)8(11)6-4-13(2)12-9(5)6;1-2/h3-4H,1-2H3;1-2H3 |
| InChIKey | WETYMJOGVWIYTR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.15 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |