C16H14F2N2 — CID 166076690
4-(3,5-difluoro-4-methylphenyl)-2,7-dimethylindazole (PubChem CID 166076690) has the molecular formula C16H14F2N2 and a molecular weight of 272.30 g/mol. Its IUPAC name is 4-(3,5-difluoro-4-methylphenyl)-2,7-dimethylindazole.
| Compound Name | 4-(3,5-difluoro-4-methylphenyl)-2,7-dimethylindazole |
|---|---|
| PubChem CID | 166076690 |
| Molecular Formula | C16H14F2N2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 4-(3,5-difluoro-4-methylphenyl)-2,7-dimethylindazole |
| SMILES | Cc1c(F)cc(-c2ccc(C)c3nn(C)cc23)cc1F |
| InChI | InChI=1S/C16H14F2N2/c1-9-4-5-12(13-8-20(3)19-16(9)13)11-6-14(17)10(2)15(18)7-11/h4-8H,1-3H3 |
| InChIKey | ARZLOHGUEVEMPH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |