C22H27ClO2 — CID 153323078
2-chloro-9,10-bis(2-methylpropoxy)-1,4-dihydroanthracene (PubChem CID 153323078) has the molecular formula C22H27ClO2 and a molecular weight of 358.91 g/mol. Its IUPAC name is 2-chloro-9,10-bis(2-methylpropoxy)-1,4-dihydroanthracene.
| Compound Name | 2-chloro-9,10-bis(2-methylpropoxy)-1,4-dihydroanthracene |
|---|---|
| PubChem CID | 153323078 |
| Molecular Formula | C22H27ClO2 |
| Molecular Weight | 358.91 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 2-chloro-9,10-bis(2-methylpropoxy)-1,4-dihydroanthracene |
| SMILES | CC(C)COc1c2c(c(OCC(C)C)c3ccccc13)CC(Cl)=CC2 |
| InChI | InChI=1S/C22H27ClO2/c1-14(2)12-24-21-17-7-5-6-8-18(17)22(25-13-15(3)4)20-11-16(23)9-10-19(20)21/h5-9,14-15H,10-13H2,1-4H3 |
| InChIKey | MUAAZQFPUDGCAZ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.91 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |