C27H21F3O5S2 — CID 153324877
[(4-methylsulfonylphenyl)-diphenyl-λ4-sulfanyl] 2-hydroxy-4-(trifluoromethyl)benzoate (PubChem CID 153324877) has the molecular formula C27H21F3O5S2 and a molecular weight of 546.59 g/mol. Its IUPAC name is [(4-methylsulfonylphenyl)-diphenyl-λ4-sulfanyl] 2-hydroxy-4-(trifluoromethyl)benzoate.
| Compound Name | [(4-methylsulfonylphenyl)-diphenyl-λ4-sulfanyl] 2-hydroxy-4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 153324877 |
| Molecular Formula | C27H21F3O5S2 |
| Molecular Weight | 546.59 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | [(4-methylsulfonylphenyl)-diphenyl-λ4-sulfanyl] 2-hydroxy-4-(trifluoromethyl)benzoate |
| SMILES | CS(=O)(=O)c1ccc(S(OC(=O)c2ccc(C(F)(F)F)cc2O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H21F3O5S2/c1-36(33,34)20-13-15-23(16-14-20)37(21-8-4-2-5-9-21,22-10-6-3-7-11-22)35-26(32)24-17-12-19(18-25(24)31)27(28,29)30/h2-18,31H,1H3 |
| InChIKey | DFRADFULKKKAME-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.59 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |