C19H35NO4 — CID 153330246
4-(3-methoxycyclobutyl)oxy-1-[2-(2-methoxyethoxymethyl)-2-methylbut-3-enyl]piperidine (PubChem CID 153330246) has the molecular formula C19H35NO4 and a molecular weight of 341.49 g/mol. Its IUPAC name is 4-(3-methoxycyclobutyl)oxy-1-[2-(2-methoxyethoxymethyl)-2-methylbut-3-enyl]piperidine.
| Compound Name | 4-(3-methoxycyclobutyl)oxy-1-[2-(2-methoxyethoxymethyl)-2-methylbut-3-enyl]piperidine |
|---|---|
| PubChem CID | 153330246 |
| Molecular Formula | C19H35NO4 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | 4-(3-methoxycyclobutyl)oxy-1-[2-(2-methoxyethoxymethyl)-2-methylbut-3-enyl]piperidine |
| SMILES | C=CC(C)(COCCOC)CN1CCC(OC2CC(OC)C2)CC1 |
| InChI | InChI=1S/C19H35NO4/c1-5-19(2,15-23-11-10-21-3)14-20-8-6-16(7-9-20)24-18-12-17(13-18)22-4/h5,16-18H,1,6-15H2,2-4H3 |
| InChIKey | RSTZCRZCVRFLBW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|