C9H20F2N2O — CID 153331044
5,5-difluoropiperidine-3-carbaldehyde;ethane;methanamine (PubChem CID 153331044) has the molecular formula C9H20F2N2O and a molecular weight of 210.27 g/mol. Its IUPAC name is 5,5-difluoropiperidine-3-carbaldehyde;ethane;methanamine.
| Compound Name | 5,5-difluoropiperidine-3-carbaldehyde;ethane;methanamine |
|---|---|
| PubChem CID | 153331044 |
| Molecular Formula | C9H20F2N2O |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 5,5-difluoropiperidine-3-carbaldehyde;ethane;methanamine |
| SMILES | CC.CN.O=CC1CNCC(F)(F)C1 |
| InChI | InChI=1S/C6H9F2NO.C2H6.CH5N/c7-6(8)1-5(3-10)2-9-4-6;2*1-2/h3,5,9H,1-2,4H2;1-2H3;2H2,1H3 |
| InChIKey | ZMMKOFGRDZGDCD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|