C8H11F2NO2 — CID 154298054
(3R,4R,5S)-5-(difluoromethyl)piperidine-3,4-dicarbaldehyde (PubChem CID 154298054) has the molecular formula C8H11F2NO2 and a molecular weight of 191.18 g/mol. Its IUPAC name is (3R,4R,5S)-5-(difluoromethyl)piperidine-3,4-dicarbaldehyde.
| Compound Name | (3R,4R,5S)-5-(difluoromethyl)piperidine-3,4-dicarbaldehyde |
|---|---|
| PubChem CID | 154298054 |
| Molecular Formula | C8H11F2NO2 |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | (3R,4R,5S)-5-(difluoromethyl)piperidine-3,4-dicarbaldehyde |
| SMILES | O=C[C@@H]1[C@@H](C=O)CNC[C@H]1C(F)F |
| InChI | InChI=1S/C8H11F2NO2/c9-8(10)6-2-11-1-5(3-12)7(6)4-13/h3-8,11H,1-2H2/t5-,6-,7-/m1/s1 |
| InChIKey | RCRRWGYWWNSMLW-FSDSQADBSA-N |
| XLogP | 0.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|