C9H14FNO2 — CID 90074972
(3R,4R,5R)-5-[(1S)-1-fluoroethyl]piperidine-3,4-dicarbaldehyde (PubChem CID 90074972) has the molecular formula C9H14FNO2 and a molecular weight of 187.21 g/mol. Its IUPAC name is (3R,4R,5R)-5-[(1S)-1-fluoroethyl]piperidine-3,4-dicarbaldehyde.
| Compound Name | (3R,4R,5R)-5-[(1S)-1-fluoroethyl]piperidine-3,4-dicarbaldehyde |
|---|---|
| PubChem CID | 90074972 |
| Molecular Formula | C9H14FNO2 |
| Molecular Weight | 187.21 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | (3R,4R,5R)-5-[(1S)-1-fluoroethyl]piperidine-3,4-dicarbaldehyde |
| SMILES | C[C@H](F)[C@H]1CNC[C@H](C=O)[C@H]1C=O |
| InChI | InChI=1S/C9H14FNO2/c1-6(10)8-3-11-2-7(4-12)9(8)5-13/h4-9,11H,2-3H2,1H3/t6-,7+,8+,9+/m0/s1 |
| InChIKey | QAHJRSQMLFDNOD-JQCXWYLXSA-N |
| XLogP | 0.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.21 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|