About 4,4-difluoropiperidine;methane;2-methylpropanal
4,4-difluoropiperidine;methane;2-methylpropanal (PubChem CID 166549261) has the molecular formula C10H21F2NO
and a molecular weight of 209.28 g/mol. Its IUPAC name is 4,4-difluoropiperidine;methane;2-methylpropanal.
Molecular Properties
| Compound Name | 4,4-difluoropiperidine;methane;2-methylpropanal |
| PubChem CID | 166549261 |
| Molecular Formula | C10H21F2NO |
| Molecular Weight | 209.28 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 4,4-difluoropiperidine;methane;2-methylpropanal |
| SMILES | C.CC(C)C=O.FC1(F)CCNCC1 |
| InChI | InChI=1S/C5H9F2N.C4H8O.CH4/c6-5(7)1-3-8-4-2-5;1-4(2)3-5;/h8H,1-4H2;3-4H,1-2H3;1H4 |
| InChIKey | YKBKMAATRRGMKX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4,4-difluoropiperidine;methane;2-methylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoropiperidine;methane;2-methylpropanal?
The IUPAC name of 4,4-difluoropiperidine;methane;2-methylpropanal (CID 166549261) is 4,4-difluoropiperidine;methane;2-methylpropanal.
What is the SMILES notation for 4,4-difluoropiperidine;methane;2-methylpropanal?
The canonical SMILES for 4,4-difluoropiperidine;methane;2-methylpropanal is C.CC(C)C=O.FC1(F)CCNCC1.
What is the InChIKey of 4,4-difluoropiperidine;methane;2-methylpropanal?
The InChIKey is YKBKMAATRRGMKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9F2N.C4H8O.CH4/c6-5(7)1-3-8-4-2-5;1-4(2)3-5;/h8H,1-4H2;3-4H,1-2H3;1H4.
What are the key properties of 4,4-difluoropiperidine;methane;2-methylpropanal?
4,4-difluoropiperidine;methane;2-methylpropanal has a molecular weight of 209.28 g/mol, XLogP of 2.48, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoropiperidine;methane;2-methylpropanal is sourced from PubChem (CID 166549261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).