About 5-methylpiperidin-3-amine;thiolane
5-methylpiperidin-3-amine;thiolane (PubChem CID 153331161) has the molecular formula C10H22N2S
and a molecular weight of 202.37 g/mol. Its IUPAC name is 5-methylpiperidin-3-amine;thiolane.
Molecular Properties
| Compound Name | 5-methylpiperidin-3-amine;thiolane |
| PubChem CID | 153331161 |
| Molecular Formula | C10H22N2S |
| Molecular Weight | 202.37 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 5-methylpiperidin-3-amine;thiolane |
| SMILES | C1CCSC1.CC1CNCC(N)C1 |
| InChI | InChI=1S/C6H14N2.C4H8S/c1-5-2-6(7)4-8-3-5;1-2-4-5-3-1/h5-6,8H,2-4,7H2,1H3;1-4H2 |
| InChIKey | DUAVQCXSGGQTOJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methylpiperidin-3-amine;thiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylpiperidin-3-amine;thiolane?
The IUPAC name of 5-methylpiperidin-3-amine;thiolane (CID 153331161) is 5-methylpiperidin-3-amine;thiolane.
What is the SMILES notation for 5-methylpiperidin-3-amine;thiolane?
The canonical SMILES for 5-methylpiperidin-3-amine;thiolane is C1CCSC1.CC1CNCC(N)C1.
What is the InChIKey of 5-methylpiperidin-3-amine;thiolane?
The InChIKey is DUAVQCXSGGQTOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2.C4H8S/c1-5-2-6(7)4-8-3-5;1-2-4-5-3-1/h5-6,8H,2-4,7H2,1H3;1-4H2.
What are the key properties of 5-methylpiperidin-3-amine;thiolane?
5-methylpiperidin-3-amine;thiolane has a molecular weight of 202.37 g/mol, XLogP of 1.46, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylpiperidin-3-amine;thiolane is sourced from PubChem (CID 153331161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).