C27H38F2N5O8P — CID 153333581
(1-methylpiperidin-4-yl) 2-[[[(2R,3R,5R)-4,4-difluoro-3-hydroxy-5-[2-oxo-4-(propan-2-ylamino)pyrimidin-1-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 153333581) has the molecular formula C27H38F2N5O8P and a molecular weight of 629.60 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) 2-[[[(2R,3R,5R)-4,4-difluoro-3-hydroxy-5-[2-oxo-4-(propan-2-ylamino)pyrimidin-1-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | (1-methylpiperidin-4-yl) 2-[[[(2R,3R,5R)-4,4-difluoro-3-hydroxy-5-[2-oxo-4-(propan-2-ylamino)pyrimidin-1-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 153333581 |
| Molecular Formula | C27H38F2N5O8P |
| Molecular Weight | 629.60 g/mol |
| Exact Mass | 629.24 |
| IUPAC Name | (1-methylpiperidin-4-yl) 2-[[[(2R,3R,5R)-4,4-difluoro-3-hydroxy-5-[2-oxo-4-(propan-2-ylamino)pyrimidin-1-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)Nc1ccn([C@@H]2O[C@H](COP(=O)(NC(C)C(=O)OC3CCN(C)CC3)Oc3ccccc3)[C@@H](O)C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C27H38F2N5O8P/c1-17(2)30-22-12-15-34(26(37)31-22)25-27(28,29)23(35)21(41-25)16-39-43(38,42-20-8-6-5-7-9-20)32-18(3)24(36)40-19-10-13-33(4)14-11-19/h5-9,12,15,17-19,21,23,25,35H,10-11,13-14,16H2,1-4H3,(H,32,38)(H,30,31,37)/t18?,21-,23-,25-,43?/m1/s1 |
| InChIKey | NBFDNOHBJFUCJW-RGZKYMROSA-N |
| XLogP | 2.78 |
| TPSA | 153.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.60 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|